dimephosphon
Modify Date: 2025-09-20 19:00:28
dimephosphon structure
|
Common Name | dimephosphon | ||
|---|---|---|---|---|
| CAS Number | 14394-26-4 | Molecular Weight | 208.19200 | |
| Density | 1.069g/cm3 | Boiling Point | 279.7ºC at 760mmHg | |
| Molecular Formula | C8H17O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.9ºC | |
| Name | 4-dimethoxyphosphoryl-4-methylpentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 279.7ºC at 760mmHg |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19200 |
| Flash Point | 136.9ºC |
| Exact Mass | 208.08600 |
| PSA | 62.41000 |
| LogP | 2.23000 |
| Vapour Pressure | 0.00396mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | MOMJYWJXUNIBGJ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(C)(C)CC(C)=O |
| HS Code | 2931900090 |
|---|
|
~%
dimephosphon CAS#:14394-26-4 |
| Literature: Zhurnal Obshchei Khimii, , vol. 22, p. 1371,1376;engl.Ausg.S.1415 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonic acid,(1,1-dimethyl-3-oxobutyl)-,dimethyl ester |
| (1,1-dimethyl-3-oxo-butyl) dimethyl phosphoric acid |
| dimephosphon |
| dimethyl (1,1-dimethyl-3-oxobutyl)phosphonate |
| (1,1-Dimethyl-3-oxo-butyl)-phosphonsaeure-dimethylester |
| dimethyl(2-methyl-4-oxopentan-2-yl)phosphonate |
| dimethyl (2-methyl-4-oxopent-2-yl)phosphonate |
| C8H17O4P |
| Dimephosphone |
| (1,1-Dimethyl-3-oxobutyl)phosphonic acid dimethyl ester |