N-(1,2,5,6-Tetrahydro-2,6-dioxo-5-ethyl-5-phenylpyridin-3-yl)acetamide
Modify Date: 2025-09-17 20:35:42
N-(1,2,5,6-Tetrahydro-2,6-dioxo-5-ethyl-5-phenylpyridin-3-yl)acetamide structure
|
Common Name | N-(1,2,5,6-Tetrahydro-2,6-dioxo-5-ethyl-5-phenylpyridin-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 14387-64-5 | Molecular Weight | 272.29900 | |
| Density | 1.24g/cm3 | Boiling Point | 547.9ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | N-(5-ethyl-2,6-dioxo-5-phenylpyridin-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 547.9ºC at 760 mmHg |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.29900 |
| Flash Point | 219.7ºC |
| Exact Mass | 272.11600 |
| PSA | 82.25000 |
| LogP | 2.12700 |
| Vapour Pressure | 4.66E-12mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | CJHLYZLMQMLMIU-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C=C(NC(C)=O)C(=O)NC1=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetamino-4-ethyl-4-phenyl-glutaconimid |
| 5-acetylamino-3-ethyl-3-phenyl-3H-pyridine-2,6-dione |
| 4-Acetamido-2-ethyl-2-phenylglutaconimid |
| 4-Acetamido-2-ethyl-2-phenylglutaconimide |