1-methyl-2,4-dioxopyrimidine-5-carboxylic acid structure
|
Common Name | 1-methyl-2,4-dioxopyrimidine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 14383-42-7 | Molecular Weight | 170.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2,4-dioxopyrimidine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6N2O4 |
|---|---|
| Molecular Weight | 170.12300 |
| Exact Mass | 170.03300 |
| PSA | 92.42000 |
| InChIKey | POFQIFXCMBGLKO-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)O)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~%
1-methyl-2,4-di... CAS#:14383-42-7 |
| Literature: Atkinson et al. Journal of the Chemical Society, 1957 , p. 2363,2365 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Methyl-5-carboxyuracil |
| 5-Carboxy-1-methyluracil |
| 1-methyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxylic acid |
| 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidin-5-carbonsaeure |
| 1-methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinecarboxylic acid |