3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile
Modify Date: 2025-08-25 17:41:21
![3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile Structure](https://image.chemsrc.com/caspic/427/143701-75-1.png)
3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile structure
|
Common Name | 3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 143701-75-1 | Molecular Weight | 359.32000 | |
| Density | N/A | Boiling Point | 527.796ºC at 760 mmHg | |
| Molecular Formula | C15H12F3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.001ºC | |
| Name | 3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 527.796ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.32000 |
| Flash Point | 273.001ºC |
| Exact Mass | 359.04400 |
| PSA | 100.45000 |
| LogP | 3.49128 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | ZTTKDUXKVPEXCG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)C(C#N)C(=O)C1CC1 |
|
~90%
3-Cyclopropyl-2... CAS#:143701-75-1 |
| Literature: Rouchaud; Neus; Eelen; Bulcke Archives of Environmental Contamination and Toxicology, 2002 , vol. 42, # 3 p. 280 - 285 |
|
~%
3-Cyclopropyl-2... CAS#:143701-75-1 |
| Literature: Rhone-Poulenc Agriculture Limited Patent: US5804532 A1, 1998 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:13885-13-7| 2-cyano-1-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-cyclopropylpropan-1,3-dione |
| Diketonitrile-isoxaflutole |
| 2-cyano-3-cyclopropyl-1-(2-methylsulphonyl-4-trifluoromethylphenyl)propan-1,3-dione |
| 2-cyano-3-cyclopropyl-1-(2-methanesulfonyl-4-trifluoromethylphenyl)propane-1,3-dione |