Imatinib carbaldehyde
Modify Date: 2025-09-10 17:18:32
Imatinib carbaldehyde structure
|
Common Name | Imatinib carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1436868-85-7 | Molecular Weight | 507.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H29N7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Imatinib carbaldehydePROTAC ABL binding moiety 1, the Imatinib (ABL inhibitor) moiety, binds to IAP ligand via a linker to form SNIPER[1]. |
| Name | PROTAC ABL binding moiety 1 |
|---|
| Description | PROTAC ABL binding moiety 1, the Imatinib (ABL inhibitor) moiety, binds to IAP ligand via a linker to form SNIPER[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H29N7O2 |
|---|---|
| Molecular Weight | 507.59 |
| InChIKey | PFQIGKMFNNGGPR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C=O)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 |