CAY10679 structure
|
Common Name | CAY10679 | ||
|---|---|---|---|---|
| CAS Number | 143673-93-2 | Molecular Weight | 402.40000 | |
| Density | 1.419g/cm3 | Boiling Point | 803.3ºC at 760 mmHg | |
| Molecular Formula | C16H26N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 439.6ºC | |
Use of CAY10679CAY10679 is an anionic oligopeptide-based bola-amphiphile that contains a hexane moiety flanked by a glycylglycine group at each end, which creates distinct hydrophilic and hydrophobic regions. |
| Name | 2-[[(6E,8E)-1,12-diamino-11-(carboxymethylamino)-2,11-dihydroxy-3,10-dioxododeca-6,8-dien-2-yl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 803.3ºC at 760 mmHg |
| Molecular Formula | C16H26N4O8 |
| Molecular Weight | 402.40000 |
| Flash Point | 439.6ºC |
| Exact Mass | 402.17500 |
| PSA | 225.30000 |
| Vapour Pressure | 7.48E-30mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | GYVCVFFEXLFTBT-NRNIAZNESA-N |
| SMILES | NCC(O)(NCC(=O)O)C(=O)C=CC=CCCC(=O)C(O)(CN)NCC(=O)O |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-suberoyldiglycylglycine |
| CAY10679 |