AGN-191129 structure
|
Common Name | AGN-191129 | ||
|---|---|---|---|---|
| CAS Number | 143656-18-2 | Molecular Weight | 354.524 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 482.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.4±28.7 °C | |
Use of AGN-191129AGN-191129, also known as Prostaglandin F2α alcohol methyl ether (PGF2α-OMe), is an analog of PGF2α in which the C-1 carboxyl group has been replaced by an O-methyl ether. The compound is reported to retain ocular hypotensive properties, but the receptors which mediate this activity have not been clearly documented. |
| Name | 1-methoxy-9alpha, 11alpha, 15s-trihydroxyprosta-5z, 13e-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.1±45.0 °C at 760 mmHg |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.524 |
| Flash Point | 245.4±28.7 °C |
| Exact Mass | 354.277008 |
| PSA | 69.92000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | VWEVSUSNDAHANL-QMCPRPJGSA-N |
| SMILES | CCCCCC(O)C=CC1C(O)CC(O)C1CC=CCCCCOC |
| (5Z,9α,11α,13E,15S)-1-Methoxyprosta-5,13-diene-9,11,15-triol |
| Prosta-5,13-diene-9,11,15-triol, 1-methoxy-, (5Z,9α,11α,13E,15S)- |
| pgf2alpha-ome |
| prostaglandin f2alpha alcohol methyl ether |