3-Methoxymethcathinone (hydrochloride) structure
|
Common Name | 3-Methoxymethcathinone (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 1435933-70-2 | Molecular Weight | 229.703 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Methoxymethcathinone (hydrochloride)3-Methoxymethcathinone (3-MeOMC) (hydrochloride) is a positional isomer of methedrone, having the methoxy group at the 3 rather than the 4 position. |
| Name | 1-(3-Methoxyphenyl)-2-(methylamino)-1-propanone hydrochloride (1: 1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16ClNO2 |
|---|---|
| Molecular Weight | 229.703 |
| Exact Mass | 229.086960 |
| PSA | 38.33000 |
| LogP | 2.67870 |
| InChIKey | GYWCNBATYQYWMK-UHFFFAOYSA-N |
| SMILES | CNC(C)C(=O)c1cccc(OC)c1.Cl |
| 1-Propanone, 1-(3-methoxyphenyl)-2-(methylamino)-, hydrochloride (1:1) |
| 1-(3-Methoxyphenyl)-2-(methylamino)-1-propanone hydrochloride (1:1) |