BCN-SS-amine structure
|
Common Name | BCN-SS-amine | ||
|---|---|---|---|---|
| CAS Number | 1435784-65-8 | Molecular Weight | 328.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BCN-SS-amineBCN-SS-amine is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | BCN-SS-amine |
|---|
| Description | BCN-SS-amine is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C15H24N2O2S2 |
|---|---|
| Molecular Weight | 328.49 |
| InChIKey | COXJSXQCKNEICM-PBWFPOADSA-N |
| SMILES | NCCSSCCNC(=O)OCC1C2CCC#CCCC21 |