3-Allyl-5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid structure
|
Common Name | 3-Allyl-5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 14357-94-9 | Molecular Weight | 276.33100 | |
| Density | 1.165g/cm3 | Boiling Point | 371.2ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.7ºC | |
| Name | 5-(cyclohexen-1-yl)-1,5-dimethyl-3-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 371.2ºC at 760 mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33100 |
| Flash Point | 148.7ºC |
| Exact Mass | 276.14700 |
| PSA | 57.69000 |
| LogP | 1.97550 |
| Vapour Pressure | 1.05E-05mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | RANMOJITRAFCCT-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)N(C)C(=O)C(C)(C2=CCCCC2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1-allyl-5-cyclohex-1-enyl-3,5-dimethyl-barbituric acid |
| 1-allyl-5-cyclohex-1-enyl-3,5-dimethyl-pyrimidine-2,4,6-trione |
| N-Allylhexobarbital |
| N-Allylmethylhexabital |
| 1-Allyl-5-cyclohex-1-enyl-3,5-dimethyl-barbitursaeure |