1-(3-Amino-4-benzyloxy-phenyl)-ethanone
Modify Date: 2025-11-26 03:38:34
1-(3-Amino-4-benzyloxy-phenyl)-ethanone structure
|
Common Name | 1-(3-Amino-4-benzyloxy-phenyl)-ethanone | ||
|---|---|---|---|---|
| CAS Number | 14347-15-0 | Molecular Weight | 241.28500 | |
| Density | 1.16g/cm3 | Boiling Point | 446.604ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.173ºC | |
| Name | 1-(3-amino-4-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 446.604ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 221.173ºC |
| Exact Mass | 241.11000 |
| PSA | 52.32000 |
| LogP | 3.63160 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | CALRVTMJQJSQEW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCc2ccccc2)c(N)c1 |
| HS Code | 2922509090 |
|---|
|
~78%
1-(3-Amino-4-be... CAS#:14347-15-0 |
| Literature: WO2005/35495 A2, ; Page/Page column 92 ; |
|
~%
1-(3-Amino-4-be... CAS#:14347-15-0 |
| Literature: US5770615 A1, ; US 5770615 A |
|
~%
1-(3-Amino-4-be... CAS#:14347-15-0 |
| Literature: Organic Process Research and Development, , vol. 15, # 6 p. 1247 - 1255 |
|
~%
1-(3-Amino-4-be... CAS#:14347-15-0 |
| Literature: Organic Process Research and Development, , vol. 15, # 6 p. 1247 - 1255 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-amino-4-benzyl-oxyacetophenone |
| 4-benzyloxy-3-amino-acetophenone |
| MFCD09753795 |
| Ethanone, 1-[3-amino-4-(phenylmethoxy)phenyl]- |
| 3'-Amino-4'-(benzyloxy)acetophenone |
| 1VR CZ DO1R |
| 1-[3-Amino-4-(benzyloxy)phenyl]ethanone |
| 1-(3-Amino-4-benzyloxy-phenyl)-ethanone |