4-({[(2S,4S)-2-[2-(4-Chlorophenyl)ethyl]-2-(1H-imidazol-1-ylmethy l)-1,3-dioxolan-4-yl]methyl}sulfanyl)aniline structure
|
Common Name | 4-({[(2S,4S)-2-[2-(4-Chlorophenyl)ethyl]-2-(1H-imidazol-1-ylmethy l)-1,3-dioxolan-4-yl]methyl}sulfanyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 143393-27-5 | Molecular Weight | 429.96300 | |
| Density | 1.31g/cm3 | Boiling Point | 647.7ºC at 760mmHg | |
| Molecular Formula | C22H24ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.5ºC | |
| Name | 4-({[(2S,4S)-2-[2-(4-Chlorophenyl)ethyl]-2-(1H-imidazol-1-ylmethy l)-1,3-dioxolan-4-yl]methyl}sulfanyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 647.7ºC at 760mmHg |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.96300 |
| Flash Point | 345.5ºC |
| Exact Mass | 429.12800 |
| PSA | 87.60000 |
| LogP | 5.23670 |
| Vapour Pressure | 1.16E-16mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | VYNIUBZKEWJOJP-UNMCSNQZSA-N |
| SMILES | Nc1ccc(SCC2COC(CCc3ccc(Cl)cc3)(Cn3ccnc3)O2)cc1 |
|
~87%
4-({[(2S,4S)-2-... CAS#:143393-27-5 |
| Literature: Syntex (U.S.A.) Inc. Patent: US5208331 A1, 1993 ; |
|
~85%
4-({[(2S,4S)-2-... CAS#:143393-27-5 |
| Literature: Syntex (U.S.A.) Inc. Patent: US5158949 A1, 1992 ; |
|
~%
4-({[(2S,4S)-2-... CAS#:143393-27-5 |
| Literature: Walker; Kertesz; Rotstein; Swinney; Berry; So -; Webb; Watson; Mak; Burton; Mills-Dunlap; Chiou; Tokes; Kurz; Kern; Chan; Salari; Mendizabal Journal of Medicinal Chemistry, 1993 , vol. 36, # 15 p. 2235 - 2237 |
| (2S,4S)-6-Fluoro-2',5'-dioxospiro[chroman-4,4'-imidazolidine]-2-carboxylic acid 2-propyl ester |
| (2S,4S)-azalanstat |
| (2S,4S)-2-[2-(4-chlorophenyl)ethyl]-2-[(1H-imidazol-1-yl)methyl]-[{(4-aminophenyl)thio}methyl]-1,3-dioxolane |
| (2S,4S)-Propyl 6-fluoro-2',5'-dioxospiro[chroman-4,4'-imidazolidine]-2-carboxylate |
| (2S,4S)-cis-2-(2-(4-chlorophenyl)ethyl)-2-(imidazol-1-yl)methyl-4-(4-aminophenylthio)methyl-1,3-dioxolane |
| (2S,4S)-6-fluoro-2,3-dihydro-2',5'-dioxospiro<4H-1-benzopyran-4,4'-imidazolidine>-2-carboxylic acid n-propyl ester |
| (2S,4S)-6-fluoro-2',5'-dioxospiro[chroman-4,4'-imidazolidine]-2-carboxylic acid n-propyl ester |
| Azetrenatat |