[5-(1-methoxyethyl)thiophen-2-yl]-phenylmethanone structure
|
Common Name | [5-(1-methoxyethyl)thiophen-2-yl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 143381-62-8 | Molecular Weight | 246.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(1-methoxyethyl)thiophen-2-yl]-phenylmethanone |
|---|
| Molecular Formula | C14H14O2S |
|---|---|
| Molecular Weight | 246.32500 |
| Exact Mass | 246.07100 |
| PSA | 54.54000 |
| LogP | 3.68650 |
| InChIKey | XBIGKDQIFQPPOE-UHFFFAOYSA-N |
| SMILES | COC(C)c1ccc(C(=O)c2ccccc2)s1 |
|
~%
[5-(1-methoxyet... CAS#:143381-62-8 |
| Literature: Bosca; Miranda; Vargas Journal of Pharmaceutical Sciences, 1992 , vol. 81, # 2 p. 181 - 182 |
|
~%
[5-(1-methoxyet... CAS#:143381-62-8 |
| Literature: Bosca; Miranda; Vargas Journal of Pharmaceutical Sciences, 1992 , vol. 81, # 2 p. 181 - 182 |
|
~0%
Detail
|
| Literature: Bosca; Miranda; Vargas Journal of Pharmaceutical Sciences, 1992 , vol. 81, # 2 p. 181 - 182 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |