2-(4-chlorophenyl)-6-hydroxy-1,3-thiazin-4-one structure
|
Common Name | 2-(4-chlorophenyl)-6-hydroxy-1,3-thiazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1433-65-4 | Molecular Weight | 239.67800 | |
| Density | 1.5g/cm3 | Boiling Point | 397.6ºC at 760mmHg | |
| Molecular Formula | C10H6ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 2-(4-chlorophenyl)-6-hydroxy-1,3-thiazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760mmHg |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.67800 |
| Flash Point | 194.3ºC |
| Exact Mass | 238.98100 |
| PSA | 78.43000 |
| LogP | 2.52930 |
| Vapour Pressure | 4.91E-07mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | XVGBBRBZACTKJH-UHFFFAOYSA-N |
| SMILES | O=c1cc(O)nc(-c2ccc(Cl)cc2)s1 |
|
~63%
2-(4-chlorophen... CAS#:1433-65-4 |
| Literature: Kuklin; Yakovlev; Smorygo; Strelkova; Ivin Russian Journal of General Chemistry, 1996 , vol. 66, # 6 p. 985 - 997 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms1366d19 |
| hms2658e06 |