AM2233 azepane isomer
Modify Date: 2025-08-22 17:13:54
AM2233 azepane isomer structure
|
Common Name | AM2233 azepane isomer | ||
|---|---|---|---|---|
| CAS Number | 1432478-91-5 | Molecular Weight | 458.335 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 577.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H23IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.2±30.1 °C | |
Use of AM2233 azepane isomerAM2233 azepane isomer is an isomer of AM2233 in which the piperidine group has been replaced with azepane. |
| Name | (2-Iodophenyl)[1-(1-methyl-3-azepanyl)-1H-indol-3-yl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H23IN2O |
| Molecular Weight | 458.335 |
| Flash Point | 303.2±30.1 °C |
| Exact Mass | 458.085510 |
| PSA | 25.24000 |
| LogP | 5.06 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | GSXZMBIYSUZVEW-UHFFFAOYSA-N |
| SMILES | CN1CCCCC(n2cc(C(=O)c3ccccc3I)c3ccccc32)C1 |
| (2-Iodophenyl)[1-(1-methyl-3-azepanyl)-1H-indol-3-yl]methanone |
| Methanone, [1-(hexahydro-1-methyl-1H-azepin-3-yl)-1H-indol-3-yl](2-iodophenyl)- |