Benzoic acid, 4-amino-,octyl ester
Modify Date: 2025-10-17 19:44:21
Benzoic acid, 4-amino-,octyl ester structure
|
Common Name | Benzoic acid, 4-amino-,octyl ester | ||
|---|---|---|---|---|
| CAS Number | 14309-41-2 | Molecular Weight | 249.34900 | |
| Density | 1.017g/cm3 | Boiling Point | 390.6ºC at 760mmHg | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.3ºC | |
| Name | octyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760mmHg |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.34900 |
| Flash Point | 226.3ºC |
| Exact Mass | 249.17300 |
| PSA | 52.32000 |
| LogP | 4.36730 |
| Vapour Pressure | 2.62E-06mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | XOEUGELJHSUYGP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1ccc(N)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,4-amino-,octyl ester |
| 4-amino-benzoic acid,octyl ester |
| octyl ester of p-aminobenzoic acid |
| octyl para-aminobenzoate |
| HMS2363M12 |
| n-octyl p-aminobenzoate |
| octyl p-aminobenzoate |