4-amino-N-(4-amino-2-methylphenyl)benzamide
Modify Date: 2025-10-08 14:31:24
4-amino-N-(4-amino-2-methylphenyl)benzamide structure
|
Common Name | 4-amino-N-(4-amino-2-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 14303-59-4 | Molecular Weight | 241.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-N-(4-amino-2-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15N3O |
|---|---|
| Molecular Weight | 241.28800 |
| Exact Mass | 241.12200 |
| PSA | 84.63000 |
| LogP | 3.95810 |
| InChIKey | YCSQADLXNHJXCN-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)ccc1NC(=O)c1ccc(N)cc1 |
|
~%
4-amino-N-(4-am... CAS#:14303-59-4 |
| Literature: Aziende Colori Nazionali Affini ACNA S.p.A. Patent: US4269769 A1, 1981 ; |
|
~%
4-amino-N-(4-am... CAS#:14303-59-4 |
| Literature: Kanyonyo, Martial R.; Poupaert, Jacques H.; Lambert, Didier M. Pharmacology and Toxicology, 1998 , vol. 82, # 1 p. 47 - 50 |
|
~%
4-amino-N-(4-am... CAS#:14303-59-4 |
| Literature: Du Pont de Nemours and Co. Patent: US2150190 , 1937 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-diamino-2'methyl-benzanilide |