(2-methoxy-2-oxoethyl)-trimethylazanium,bromide
Modify Date: 2025-08-25 17:39:29
(2-methoxy-2-oxoethyl)-trimethylazanium,bromide structure
|
Common Name | (2-methoxy-2-oxoethyl)-trimethylazanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 14290-79-0 | Molecular Weight | 212.08500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methoxy-2-oxoethyl)-trimethylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H14BrNO2 |
|---|---|
| Molecular Weight | 212.08500 |
| Exact Mass | 211.02100 |
| PSA | 26.30000 |
| InChIKey | FKGRDKMZAIKLTD-UHFFFAOYSA-M |
| SMILES | COC(=O)C[N+](C)(C)C.[Br-] |
|
~%
(2-methoxy-2-ox... CAS#:14290-79-0 |
| Literature: Journal of the American Chemical Society, , vol. 48, p. 2701 |
|
~%
(2-methoxy-2-ox... CAS#:14290-79-0 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 5880,5883 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Betaine methyl ester bromide |
| Methylbetainmethylesterbromid |
| Methoxycarbonylmethyl-trimethyl-ammonium,Bromid |
| Dimethylamino-essigsaeure-methylester-methobromid |
| methoxycarbonylmethyl-trimethyl-ammonium,bromide |
| Methylbetainbromid |
| 2-methoxy-N,N,N-trimethyl-2-oxoethanaminium bromide |