ARN1203 structure
|
Common Name | ARN1203 | ||
|---|---|---|---|---|
| CAS Number | 1428445-15-1 | Molecular Weight | 379.552 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 543.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H38FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.2±30.1 °C | |
Use of ARN1203ARN1203 is a fluorinated analog of AEA that serves as a substrate of FAAH (Km = 29 M). |
| Name | (5Z,8Z,11Z,14Z)-N-(3-fluoro-2-hydroxypropyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.0±50.0 °C at 760 mmHg |
| Molecular Formula | C23H38FNO2 |
| Molecular Weight | 379.552 |
| Flash Point | 282.2±30.1 °C |
| Exact Mass | 379.288666 |
| PSA | 49.33000 |
| LogP | 6.10 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | IXPSZMYVPAPSRW-DOFZRALJSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCC(O)CF |
| (5Z,8Z,11Z,14Z)-N-(3-Fluoro-2-hydroxypropyl)-5,8,11,14-icosatetraenamide |
| 5,8,11,14-Eicosatetraenamide, N-(3-fluoro-2-hydroxypropyl)-, (5Z,8Z,11Z,14Z)- |