2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide
Modify Date: 2026-05-17 12:37:28
![2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide Structure](https://www.chemsrc.com/extcaspic/216/1428362-81-5.png)
2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide structure
|
Common Name | 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 1428362-81-5 | Molecular Weight | 388.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H28N2O3S |
|---|---|
| Molecular Weight | 388.5 |
| InChIKey | HPHREUDQQFWRJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)NCCN2CCC(CC2)C3=CC=CS3)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: Molecular formula of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is C21H28N2O3S. |
| Q: What is the molecular weight of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: Molecular weight of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is 388.5. |
| Q: What is the English name of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: The English name of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide. |
| Q: What is the SMILES notation of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: SMILES notation of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is COC1=C(C=C(C=C1)CC(=O)NCCN2CCC(CC2)C3=CC=CS3)OC. |
| Q: What is the CAS number of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: CAS number of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is 1428362-81-5. |
| Q: What is the InChIKey of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide? |
| A: InChIKey of 2-(3,4-Dimethoxyphenyl)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}acetamide is HPHREUDQQFWRJN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1428362-81-5? |
| A: Chinese name of 1428362-81-5 is 1428362-81-5. |