AM694 3-iodo isomer structure
|
Common Name | AM694 3-iodo isomer | ||
|---|---|---|---|---|
| CAS Number | 1427325-91-4 | Molecular Weight | 435.274 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 538.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H19FINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.4±27.3 °C | |
Use of AM694 3-iodo isomerAM694 3-iodo isomer is an analog of AM694 which contains a 3-iodophenyl group linked by methanone to the indole base. Its affinity for CB receptors has not been determined. |
| Name | [1-(5-Fluoropentyl)-1H-indol-3-yl](3-iodophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.4±40.0 °C at 760 mmHg |
| Molecular Formula | C20H19FINO |
| Molecular Weight | 435.274 |
| Flash Point | 279.4±27.3 °C |
| Exact Mass | 435.049530 |
| PSA | 22.00000 |
| LogP | 6.08 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | QIKGCUFVLWGTKU-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(I)c1)c1cn(CCCCCF)c2ccccc12 |
| [1-(5-Fluoropentyl)-1H-indol-3-yl](3-iodophenyl)methanone |
| Methanone, [1-(5-fluoropentyl)-1H-indol-3-yl](3-iodophenyl)- |