Bph-1218
Bph-1218 structure
|
Common Name | Bph-1218 | ||
|---|---|---|---|---|
| CAS Number | 1426824-36-3 | Molecular Weight | 396.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30N2O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bph-1218BPH-1218 is a SQS inhibitor. |
| Name | BPH-1218 |
|---|
| Description | BPH-1218 is a SQS inhibitor. |
|---|---|
| References | 1. Barry MJ, Williford WO, Chang Y, Machi M, Jones KM, Walker-Corkery E, Lepor H. Benign prostatic hyperplasia specific health status measures in clinical research: how much change in the American Urological Association symptom index and the benign prostatic hyperplasia impact index is perceptible to patients? J Urol. 1995 Nov;154(5):1770-4. PubMed PMID: 7563343. |
| Molecular Formula | C15H30N2O6P2 |
|---|---|
| Molecular Weight | 396.36 |
| InChIKey | GYTSEUQBLYSXFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCn1cc[n+](CC(P(=O)([O-])O)P(=O)(O)O)c1 |