Bis(triphenylphosphine)nickel(II)chloride structure
|
Common Name | Bis(triphenylphosphine)nickel(II)chloride | ||
|---|---|---|---|---|
| CAS Number | 14264-16-5 | Molecular Weight | 654.17000 | |
| Density | N/A | Boiling Point | 360ºCat 760 mmHg | |
| Molecular Formula | C36H30Cl2NiP2 | Melting Point | 250ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 181.7ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | Bis(triphenylphosphine)nickel(II) Dichloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360ºCat 760 mmHg |
|---|---|
| Melting Point | 250ºC (dec.) |
| Molecular Formula | C36H30Cl2NiP2 |
| Molecular Weight | 654.17000 |
| Flash Point | 181.7ºC |
| Exact Mass | 652.05500 |
| PSA | 27.18000 |
| LogP | 4.58310 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L |
| SMILES | Cl[Ni]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H350 |
| Precautionary Statements | P201-P280-P308 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R20/21/22;R34;R45 |
| Safety Phrases | S26-S36/37/39-S45-S53 |
| RIDADR | UN2923 |
| WGK Germany | 3 |
| RTECS | QR6170000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 29310095 |
|
~14%
Bis(triphenylph... CAS#:14264-16-5
Detail
|
| Literature: Journal of the American Chemical Society, , vol. 125, # 14 p. 4350 - 4361 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Ni: MVol.C2, 8.18.1, page 1041 - 1052 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Ni: MVol.C2, 8.18.1, page 1041 - 1052 |
|
~%
Bis(triphenylph... CAS#:14264-16-5
Detail
|
| Literature: Inorganica Chimica Acta, , vol. 96, p. 179 - 186 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Liebigs Annalen der Chemie, , vol. 560, p. 104 - 116 |
|
~%
Bis(triphenylph... CAS#:14264-16-5
Detail
|
| Literature: Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), , # 21 p. 3075 - 3084 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 46, p. 686 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 53, # 1 p. 139 - 145 |
|
~%
Bis(triphenylph... CAS#:14264-16-5 |
| Literature: Ni: Org.Verb.2, 1.4.1.4, page 78 - 83 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 29310095 |
|---|
| EINECS 238-154-8 |
| Bis(triphenylphosphine)nickel(II) dichloride |
| MFCD00009592 |
| Bis(triphenylphosphine)nickel(II)chloride |
| NiCl2(PPh3)2 |
| Dichlorobis(triphenylphosphine)nickel(II) |
| Nickel(II)bis(triphenylphosphine) dichloride |
| Phosphine, tributyl-, compd. with nickelchloride (2_1) |