8-(2-aminoethylamino)-1,3-dimethyl-7H-purine-2,6-dione structure
|
Common Name | 8-(2-aminoethylamino)-1,3-dimethyl-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 14251-32-2 | Molecular Weight | 238.24600 | |
| Density | 1.465g/cm3 | Boiling Point | 492.2ºC at 760mmHg | |
| Molecular Formula | C9H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | 8-(2-aminoethylamino)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760mmHg |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.24600 |
| Flash Point | 251.5ºC |
| Exact Mass | 238.11800 |
| PSA | 113.96000 |
| Vapour Pressure | 7.84E-10mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | RUILVTDZEFWNPQ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(NCCN)nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Theophylline ethylene-diamine |