2-chloro-3-(4-methylphenyl)sulfonylpropanenitrile structure
|
Common Name | 2-chloro-3-(4-methylphenyl)sulfonylpropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 1424-47-1 | Molecular Weight | 243.71000 | |
| Density | 1.312g/cm3 | Boiling Point | 429.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 2-chloro-3-(4-methylphenyl)sulfonylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.71000 |
| Flash Point | 213.8ºC |
| Exact Mass | 243.01200 |
| PSA | 66.31000 |
| LogP | 2.98048 |
| Vapour Pressure | 1.35E-07mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | KBYXUMBHNAGPSD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(Cl)C#N)cc1 |
|
~80%
2-chloro-3-(4-m... CAS#:1424-47-1 |
| Literature: Zvezdova; Stoeva; Aleksiev Journal of the Chinese Chemical Society, 2007 , vol. 54, # 2 p. 447 - 452 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-3-p-tolylsulfonyl-propionitril |