tert-butyl N-benzyl-N-but-3-ynylcarbamate structure
|
Common Name | tert-butyl N-benzyl-N-but-3-ynylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 142301-75-5 | Molecular Weight | 259.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-benzyl-N-but-3-ynylcarbamate |
|---|
| Molecular Formula | C16H21NO2 |
|---|---|
| Molecular Weight | 259.34300 |
| Exact Mass | 259.15700 |
| PSA | 29.54000 |
| LogP | 3.44700 |
| InChIKey | VYGPDEKXPASVAX-UHFFFAOYSA-N |
| SMILES | C#CCCN(Cc1ccccc1)C(=O)OC(C)(C)C |
|
~%
tert-butyl N-be... CAS#:142301-75-5 |
| Literature: Hirai, Yoshiro; Terada, Takashi; Yamazaki, Takao; Momose, Takefumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 4 p. 509 - 516 |
|
~%
tert-butyl N-be... CAS#:142301-75-5 |
| Literature: Li, Meiling; Hawkins, Alison; Barber, David M.; Bultinck, Patrick; Herrebout, Wouter; Dixon, Darren J. Chemical Communications, 2013 , vol. 49, # 46 p. 5265 - 5267 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |