6-(1,3-dihydrobenzimidazol-2-ylidene)-4-methylcyclohexa-2,4-dien-1-one structure
|
Common Name | 6-(1,3-dihydrobenzimidazol-2-ylidene)-4-methylcyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 14225-73-1 | Molecular Weight | 224.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(1,3-dihydrobenzimidazol-2-ylidene)-4-methylcyclohexa-2,4-dien-1-one |
|---|
| Molecular Formula | C14H12N2O |
|---|---|
| Molecular Weight | 224.25800 |
| Exact Mass | 224.09500 |
| PSA | 48.65000 |
| LogP | 2.01300 |
| InChIKey | DHGDWTMPWISXNH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(-c2nc3ccccc3[nH]2)c1 |
|
~77%
6-(1,3-dihydrob... CAS#:14225-73-1 |
| Literature: Bulletin of the Chemical Society of Ethiopia, , vol. 24, # 3 p. 391 - 400 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |