3,5-Dihydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one structure
|
Common Name | 3,5-Dihydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 14221-65-9 | Molecular Weight | 344.31500 | |
| Density | 1.407g/cm3 | Boiling Point | 579.7ºC at 760 mmHg | |
| Molecular Formula | C18H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 3,5-dihydroxy-6,7,8-trimethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 579.7ºC at 760 mmHg |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.31500 |
| Flash Point | 213.1ºC |
| Exact Mass | 344.09000 |
| PSA | 98.36000 |
| LogP | 2.89700 |
| Vapour Pressure | 2.78E-14mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | TYZXGIOTNSBKDB-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1OC |
| HS Code | 2914509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5-Dihydroxy-6,7,8-trimethoxy-flavon |
| TYZXGIOTNSBKDB-UHFFFAOYSA |
| HMS2271C05 |
| 3,5-Dihydroxy-6,7,8-trimethoxyflavone |
| 3,5-dihydroxy-6,7,8-trimethoxy-2-phenyl-chromen-4-one |
| 4H-1-Benzopyran-4-one,3,5-dihydroxy-6,7,8-trimethoxy-2-phenyl |