5-acetoxy-1,1,1,2,2,3,3-heptafluoro-5-iodo-pentane structure
|
Common Name | 5-acetoxy-1,1,1,2,2,3,3-heptafluoro-5-iodo-pentane | ||
|---|---|---|---|---|
| CAS Number | 1422-64-6 | Molecular Weight | 382.01500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F7IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-acetoxy-1,1,1,2,2,3,3-heptafluoro-5-iodo-pentane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6F7IO2 |
|---|---|
| Molecular Weight | 382.01500 |
| Exact Mass | 381.93000 |
| PSA | 26.30000 |
| LogP | 3.53360 |
| InChIKey | GGBAKRNOYRHZCU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(I)CC(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 5-Acetoxy-1.1.1.2.2.3.3-hexafluor-5-iod-pentan |
| 1-Acetoxy-1-iod-3.3.4.4.5.5.5-heptafluor-pentan |
| 1-Jod-3,3,4,4,5,5,5-heptafluor-pentylacetat |