LAPISTERIDE structure
|
Common Name | LAPISTERIDE | ||
|---|---|---|---|---|
| CAS Number | 142139-60-4 | Molecular Weight | 464.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H40N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LAPISTERIDELapisteride (CS 891) is an orally active 5α-reductase inhibitor. Lapisteride can be used in cancer research[1]. |
| Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-[2-(4-methoxyphenyl)propan-2-yl]-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Lapisteride (CS 891) is an orally active 5α-reductase inhibitor. Lapisteride can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H40N2O3 |
|---|---|
| Molecular Weight | 464.64000 |
| Exact Mass | 464.30400 |
| PSA | 74.41000 |
| LogP | 6.07610 |
| InChIKey | NAGKTIAFDQEFJI-DPMIIFTQSA-N |
| SMILES | COc1ccc(C(C)(C)NC(=O)C2CCC3C4CCC5NC(=O)C=CC5(C)C4CCC23C)cc1 |
| UNII-T50SJ23G82 |
| Lapisteride |
| CS 891 |