N-t-BOC-D-Leucinol structure
|
Common Name | N-t-BOC-D-Leucinol | ||
|---|---|---|---|---|
| CAS Number | 142121-48-0 | Molecular Weight | 217.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 319.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H23NO3 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 146.9±23.2 °C | |
| Name | tert-butyl N-(1-hydroxy-4-methylpentan-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.3±25.0 °C at 760 mmHg |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.305 |
| Flash Point | 146.9±23.2 °C |
| Exact Mass | 217.167801 |
| PSA | 58.56000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | LQTMEOSBXTVYRM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CO)NC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
|
~%
N-t-BOC-D-Leucinol CAS#:142121-48-0 |
| Literature: TAISHO PHARMACEUTICAL CO., LTD; Moriya, Minoru; Ohta, Hiroshi; Yamamoto, Shuji; Abe, Kumi; Araki, Yuko; Sun, Xiang-Min; Wakasugi, Daisuke Patent: US2013/331571 A1, 2013 ; Location in patent: Paragraph 0179; 0180 ; |
|
~89%
N-t-BOC-D-Leucinol CAS#:142121-48-0 |
| Literature: Ermert, Philipp; Meyer, Jsabella; Stucki, Christoph; Schneebeli, Joerg; Obrecht, Jean-Pierre Tetrahedron Letters, 1988 , vol. 29, # 11 p. 1265 - 1268 |
|
~%
N-t-BOC-D-Leucinol CAS#:142121-48-0 |
| Literature: Tetrahedron Letters, , vol. 29, # 11 p. 1265 - 1268 |
|
~%
N-t-BOC-D-Leucinol CAS#:142121-48-0 |
| Literature: Tetrahedron Letters, , vol. 29, # 11 p. 1265 - 1268 |
|
~%
N-t-BOC-D-Leucinol CAS#:142121-48-0 |
| Literature: Tetrahedron Letters, , vol. 29, # 11 p. 1265 - 1268 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-D-leucinol |
| Boc-DL-Leucinol |
| (R)-tert-Butyl (1-hydroxy-4-methylpentan-2-yl)carbamate |
| N-t-BOC-D-Leucinol |
| (R)-N-(tert-Butoxycarbonyl)leucinol |
| Carbamic acid, N-[(1R)-1-(hydroxymethyl)-3-methylbutyl]-, 1,1-dimethylethyl ester |
| Boc-D-Leu-ol |
| Boc-(R)-2-amino-4-methyl-1-pentanol |
| N-Boc-DL-Leucinol |
| 2(R)-t-butoxycarbonylamino-4-methylpentanol |
| Boc-Leu-ol |
| 2-Methyl-2-propanyl [(2R)-1-hydroxy-4-methyl-2-pentanyl]carbamate |
| N-BOC-D-Leucinol |
| ((R)-1-hydroxymethyl-3-methyl-butyl)-carbamic acid tert-butyl ester |
| tert-Butyl [(2R)-1-hydroxy-4-methylpentan-2-yl]carbamate |