9H-Purine-9-methanol,6-(cyclopentylthio)- structure
|
Common Name | 9H-Purine-9-methanol,6-(cyclopentylthio)- | ||
|---|---|---|---|---|
| CAS Number | 14196-96-4 | Molecular Weight | 250.32000 | |
| Density | 1.55g/cm3 | Boiling Point | 474.2ºC at 760mmHg | |
| Molecular Formula | C11H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | (6-cyclopentylsulfanylpurin-9-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760mmHg |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.32000 |
| Flash Point | 240.6ºC |
| Exact Mass | 250.08900 |
| PSA | 89.13000 |
| LogP | 1.81080 |
| Vapour Pressure | 8.5E-10mmHg at 25°C |
| Index of Refraction | 1.777 |
| InChIKey | GCEYOLZOWJIRPR-UHFFFAOYSA-N |
| SMILES | OCn1cnc2c(SC3CCCC3)ncnc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Cyclopentylthio-9-hydroxymethylpurine |
| 6-Cyclopentylmercapto-9-hydroxymethyl-9H-purin |