(S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
Modify Date: 2025-08-25 16:40:05
(S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxy-3-methoxyphenyl)propanoic acid structure
|
Common Name | (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxy-3-methoxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 141900-23-4 | Molecular Weight | 311.330 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 506.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.0±30.1 °C | |
| Name | (2S)-3-(4-hydroxy-3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.3±50.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.330 |
| Flash Point | 260.0±30.1 °C |
| Exact Mass | 311.136902 |
| PSA | 105.09000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | DVQDNEXWFJBUAV-JTQLQIEISA-N |
| SMILES | COc1cc(CC(NC(=O)OC(C)(C)C)C(=O)O)ccc1O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-3-methoxy- |
| Boc-3-methoxy-L-tyrosine |
| 3-Methoxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-tyrosine |
| (2S)-2-[(tert-butoxycarbonyl)amino]-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| (S)-2-(Boc-amino)-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |