1,3-Diallyl-5,5-diethylpyrimidine-2,4,6(1H,3H,5H)-trione structure
|
Common Name | 1,3-Diallyl-5,5-diethylpyrimidine-2,4,6(1H,3H,5H)-trione | ||
|---|---|---|---|---|
| CAS Number | 14167-74-9 | Molecular Weight | 264.32000 | |
| Density | 1.057g/cm3 | Boiling Point | 341.2ºC at 760mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.7ºC | |
| Name | 5,5-diethyl-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 341.2ºC at 760mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 129.7ºC |
| Exact Mass | 264.14700 |
| PSA | 57.69000 |
| LogP | 1.83140 |
| Vapour Pressure | 8.17E-05mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | OQJNEKQRESAPIR-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)N(CC=C)C(=O)C(CC)(CC)C1=O |
| HS Code | 2933540000 |
|---|
|
~%
1,3-Diallyl-5,5... CAS#:14167-74-9 |
| Literature: Merck Patent: DE258058 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 930 |
|
~%
1,3-Diallyl-5,5... CAS#:14167-74-9 |
| Literature: Kaku et al. Yakugaku Zasshi, 1954 , vol. 74, p. 122 Chem.Abstr., 1955 , p. 1569 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5,5-diethyl-1,3-diallyl-barbituric acid |
| 1,3-Diallyl-5,5-diethylbarbituric acid |
| 5,5-Diaethyl-1,3-diallyl-barbitursaeure |
| BARBITURIC ACID,1,3-DIALLYL-5,5-DIETHYL |
| 1,3-diallyl-5,5-diethyl-pyrimidine-2,4,6-trione |
| N.N'-Diallylbarbital |