(5-Amino-2-butyl-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]methanone structure
|
Common Name | (5-Amino-2-butyl-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 141644-91-9 | Molecular Weight | 478.66600 | |
| Density | 1.066 | Boiling Point | 630.151ºC at 760 mmHg | |
| Molecular Formula | C30H42N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.904ºC | |
| Name | (5-amino-2-butyl-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.066 |
|---|---|
| Boiling Point | 630.151ºC at 760 mmHg |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.66600 |
| Flash Point | 334.904ºC |
| Exact Mass | 478.32000 |
| PSA | 68.70000 |
| LogP | 7.84090 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | SPIIBUQYWNFELT-UHFFFAOYSA-N |
| SMILES | CCCCc1oc2ccc(N)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-amino 3-[4-(3-di-n-butylamino-propoxy)benzoyl]-2-n-butylbenzofuran |
| (5-amino-2-butyl-benzofuran-3-yl)-[4-(3-dibutylamino-propoxy)phenyl]methanone |
| 2-n-butyl-3-{4-[3-(di-n-butylamino)propoxy]-benzoyl}-5-aminobenzofuran |
| (5-amino-2-butyl-1-benzofuran-3-yl)[4-[3'-(di-n-butylamino)propoxy]-phenyl]-methanone |
| 5-amino-2-butyl-3-(4-[3-(dibutylamino)propoxy]benzoyl) benzofuran |
| MET057 |