4-[3-bromo-2-(trifluoromethyl)phenyl]-4-oxobutanoic acid
Modify Date: 2024-09-27 12:02:48
![4-[3-bromo-2-(trifluoromethyl)phenyl]-4-oxobutanoic acid Structure](https://image.chemsrc.com/caspic/426/1416373-70-0.png)
4-[3-bromo-2-(trifluoromethyl)phenyl]-4-oxobutanoic acid structure
|
Common Name | 4-[3-bromo-2-(trifluoromethyl)phenyl]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1416373-70-0 | Molecular Weight | 325.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-bromo-2-(trifluoromethyl)phenyl]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8BrF3O3 |
|---|---|
| Molecular Weight | 325.07900 |
| Exact Mass | 323.96100 |
| PSA | 54.37000 |
| LogP | 3.51540 |
| InChIKey | ACJACJHJOMKLNW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1cccc(Br)c1C(F)(F)F |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(3-Bromo-2-trifluoromethylphenyl)-4-oxo-butyric acid |