d-tryptophan benzyl ester 98 structure
|
Common Name | d-tryptophan benzyl ester 98 | ||
|---|---|---|---|---|
| CAS Number | 141595-98-4 | Molecular Weight | 294.34800 | |
| Density | 1.247g/cm3 | Boiling Point | 489.9ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O2 | Melting Point | 77-80ºC(lit.) | |
| MSDS | USA | Flash Point | 250.1ºC | |
| Name | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 489.9ºC at 760 mmHg |
| Melting Point | 77-80ºC(lit.) |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.34800 |
| Flash Point | 250.1ºC |
| Exact Mass | 294.13700 |
| PSA | 68.11000 |
| LogP | 3.48140 |
| Vapour Pressure | 9.59E-10mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | TYQYRKDGHAPZRF-MRXNPFEDSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
d-tryptophan be... CAS#:141595-98-4 |
| Literature: WO2010/148191 A2, ; Page/Page column 45-49; 59 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| D-Tryptophan,phenylmethyl ester |
| D-Tryptophanbenzyl ester |