Evobrutinib
Modify Date: 2025-08-27 13:23:56
Evobrutinib structure
|
Common Name | Evobrutinib | ||
|---|---|---|---|---|
| CAS Number | 1415823-73-2 | Molecular Weight | 429.514 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 683.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H27N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.1±31.5 °C | |
Use of EvobrutinibEvobrutinib is an inhibitor of Bruton's tyrosin kinase (Btk) inhibitor extracted from patent US20140162983 example 0174. |
| Name | evobrutinib |
|---|---|
| Synonym | More Synonyms |
| Description | Evobrutinib is an inhibitor of Bruton's tyrosin kinase (Btk) inhibitor extracted from patent US20140162983 example 0174. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 683.4±55.0 °C at 760 mmHg |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.514 |
| Flash Point | 367.1±31.5 °C |
| Exact Mass | 429.216461 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | QUIWHXQETADMGN-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCC(CNc2ncnc(N)c2-c2ccc(Oc3ccccc3)cc2)CC1 |
| UNII:ZA45457L1K |
| 1-[4-({[6-Amino-5-(4-phenoxyphenyl)-4-pyrimidinyl]amino}methyl)-1-piperidinyl]-2-propen-1-one |
| 2-Propen-1-one, 1-[4-[[[6-amino-5-(4-phenoxyphenyl)-4-pyrimidinyl]amino]methyl]-1-piperidinyl]- |
| evobrutinib |