TAM558 intermediate-5
Modify Date: 2025-08-25 18:36:19
TAM558 intermediate-5 structure
|
Common Name | TAM558 intermediate-5 | ||
|---|---|---|---|---|
| CAS Number | 1415659-15-2 | Molecular Weight | 772.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H65N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAM558 intermediate-5TAM558 intermediate-54 is an intermediate in the synthesis of TAM558 (HY-148127).TAM558 is the payload molecule used in the synthesis of OMTX705.OMTX705 is a humanized anti-fibroblast activation protein (FAP) antibody that binds to the cytolysin TAM470 (HY-148128) and has anti-tumor activity[1]. |
| Name | TAM558 intermediate-5 |
|---|
| Description | TAM558 intermediate-54 is an intermediate in the synthesis of TAM558 (HY-148127).TAM558 is the payload molecule used in the synthesis of OMTX705.OMTX705 is a humanized anti-fibroblast activation protein (FAP) antibody that binds to the cytolysin TAM470 (HY-148128) and has anti-tumor activity[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C41H65N5O7S |
|---|---|
| Molecular Weight | 772.05 |
| InChIKey | ACRSOTAEOXNROB-WPIAVMABSA-N |
| SMILES | CCCOC(CC(C(C)C)N(CCC)C(=O)C(NC(=O)C1CCCCN1C)C(C)CC)c1nc(C(=O)NC(Cc2ccc(O)cc2)CC(C)C(=O)O)cs1 |