2-methyl-3-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4-one structure
|
Common Name | 2-methyl-3-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 14133-24-5 | Molecular Weight | 251.28300 | |
| Density | 1.22g/cm3 | Boiling Point | 429.5ºC at 760mmHg | |
| Molecular Formula | C15H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 2-methyl-3-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760mmHg |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28300 |
| Flash Point | 213.6ºC |
| Exact Mass | 251.10600 |
| PSA | 47.78000 |
| LogP | 2.39750 |
| Vapour Pressure | 1.39E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | NADVLYCKRMAINU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(C)nc2ncccc2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methyl-3-o-tolyl-3H-pyrido[2,3-d]pyrimidin-4-one |
| 2-Methyl-3-o-tolyl-8-aza-4(3H)-chinazolinon |
| Kr-100 |
| 2-Methyl-3-(o-tolyl)-4-oxo-3,4-dihydropyrido<2,3-d>pyrimidin |
| 2-methyl-3-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4(3h)-one |
| 2-Methyl-3-(2'-methylphenyl)-4-oxo-2,3-dihydropyrido<2,3-d>pyrimidin |