2-(3-methoxypropyl)-1H-thioxantheno[2,1,9-def]isoquinoline-1,3(2H)-dione structure
|
Common Name | 2-(3-methoxypropyl)-1H-thioxantheno[2,1,9-def]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 14121-47-2 | Molecular Weight | 375.44000 | |
| Density | 1.38g/cm3 | Boiling Point | 610.1ºC at 760mmHg | |
| Molecular Formula | C22H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.8ºC | |
| Name | 2-(3-Methoxypropyl)-1H-benzo[3,4]isothiochromeno[7,8,1-def]isoqui noline-1,3(2H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 610.1ºC at 760mmHg |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.44000 |
| Flash Point | 322.8ºC |
| Exact Mass | 375.09300 |
| PSA | 76.54000 |
| LogP | 4.35710 |
| Vapour Pressure | 7.93E-15mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | GIEARNNTYXJWQQ-UHFFFAOYSA-N |
| SMILES | COCCCn1c(=O)c2ccc3sc4ccccc4c4ccc(c1=O)c2c34 |
| HS Code | 2934999090 |
|---|
|
~%
2-(3-methoxypro... CAS#:14121-47-2 |
| Literature: Grayshan,P.H. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 33 - 38 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(3-Methoxypropyl)benzo<k,l>thioxanthen-3,4-dicarboximid |
| 2-(3-methoxy-propyl)-thioxantheno[2,1,9-def]isoquinoline-1,3-dione |
| 2-(3-methoxypropyl)-1H-thioxantheno(2,1,9-def)isoquinoline-1,3(2H)-dione |
| 2-(3-methoxyphenylthio)benzoic acid |
| Benzoic acid,2-[(3-methoxyphenyl)thio] |
| Methoxyphenylthiobenzoesaeure |