6-methyl-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole structure
|
Common Name | 6-methyl-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole | ||
|---|---|---|---|---|
| CAS Number | 14120-28-6 | Molecular Weight | 203.30300 | |
| Density | 1.236g/cm3 | Boiling Point | 386.7ºC at 760 mmHg | |
| Molecular Formula | C12H13NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.7ºC | |
| Name | 6-methyl-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 386.7ºC at 760 mmHg |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.30300 |
| Flash Point | 187.7ºC |
| Exact Mass | 203.07700 |
| PSA | 41.09000 |
| LogP | 3.26560 |
| Vapour Pressure | 7.71E-06mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | LPDDAEMGWDNIGQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c3c([nH]c12)CCSC3 |
|
~%
6-methyl-1,3,4,... CAS#:14120-28-6 |
| Literature: Young,T.E. et al. Journal of Organic Chemistry, 1967 , vol. 32, p. 3622 - 3626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |