1,3-BIS(3-FORMYLPHENOXY)PROPANE structure
|
Common Name | 1,3-BIS(3-FORMYLPHENOXY)PROPANE | ||
|---|---|---|---|---|
| CAS Number | 141032-56-6 | Molecular Weight | 284.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[3-(3-formylphenoxy)propoxy]benzaldehyde |
|---|
| Molecular Formula | C17H16O4 |
|---|---|
| Molecular Weight | 284.30700 |
| Exact Mass | 284.10500 |
| PSA | 52.60000 |
| LogP | 3.15950 |
| InChIKey | CYIKEJAETJNNQZ-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc(OCCCOc2cccc(C=O)c2)c1 |
| HS Code | 2912299000 |
|---|
|
~71%
1,3-BIS(3-FORMY... CAS#:141032-56-6 |
| Literature: Kamal, Ahmed; Shaheer Malik; Bajee, Shaik; Azeeza, Shaik; Faazil, Shaikh; Ramakrishna, Sistla; Naidu; Vishnuwardhan European Journal of Medicinal Chemistry, 2011 , vol. 46, # 8 p. 3274 - 3281 |
|
~85%
1,3-BIS(3-FORMY... CAS#:141032-56-6 |
| Literature: Dyker, Gerald; Koerning, Jutta; Stirner, Wolfgang European Journal of Organic Chemistry, 1998 , # 1 p. 149 - 154 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2912299000 |
|---|---|
| Summary | 2912299000. other cyclic aldehydes without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |