ethyl 4-methyl-2-oxoquinoline-1-carboxylate structure
|
Common Name | ethyl 4-methyl-2-oxoquinoline-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 141031-16-5 | Molecular Weight | 231.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-methyl-2-oxoquinoline-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO3 |
|---|---|
| Molecular Weight | 231.24700 |
| Exact Mass | 231.09000 |
| PSA | 48.30000 |
| LogP | 2.31450 |
| InChIKey | XAGSTYCYEHNFLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)n1c(=O)cc(C)c2ccccc21 |
|
~76%
ethyl 4-methyl-... CAS#:141031-16-5 |
| Literature: Deshmukh; Chavan Journal of the Indian Chemical Society, 1991 , vol. 68, # 10 p. 573 - 574 |
|
~%
ethyl 4-methyl-... CAS#:141031-16-5 |
| Literature: Deshmukh; Chavan Journal of the Indian Chemical Society, 1991 , vol. 68, # 10 p. 573 - 574 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N1-carbethoxy-4-methyl-2-quinolon-2(1H)-one |
| 1(2H)-Quinolinecarboxylic acid,4-methyl-2-oxo-,ethyl ester |