4-[methyl(phenyl)sulfamoyl]thiophene-3-carboxylic acid structure
|
Common Name | 4-[methyl(phenyl)sulfamoyl]thiophene-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 140947-42-8 | Molecular Weight | 297.35000 | |
| Density | 1.493g/cm3 | Boiling Point | 494.5ºC at 760 mmHg | |
| Molecular Formula | C12H11NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.9ºC | |
| Name | 4-[methyl(phenyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.493g/cm3 |
|---|---|
| Boiling Point | 494.5ºC at 760 mmHg |
| Molecular Formula | C12H11NO4S2 |
| Molecular Weight | 297.35000 |
| Flash Point | 252.9ºC |
| Exact Mass | 297.01300 |
| PSA | 111.30000 |
| LogP | 3.35220 |
| Vapour Pressure | 1.35E-10mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | SKRYGNMPKTVHFS-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cscc1C(=O)O |
|
~92%
4-[methyl(pheny... CAS#:140947-42-8 |
| Literature: Diaz, Juan A.; Morante, M. Esther; Vega, Salvador; Darias, Victoriano; Abdala, Susana; Delgado, Laura; De Las Heras, Beatriz; Villar, Angel; Vivas, Jose Maria Archiv der Pharmazie, 1996 , vol. 329, # 5 p. 229 - 238 |
|
~%
4-[methyl(pheny... CAS#:140947-42-8 |
| Literature: Vega; Diaz Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 6 p. 1509 - 1512 |
|
~%
4-[methyl(pheny... CAS#:140947-42-8 |
| Literature: Vega; Diaz Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 6 p. 1509 - 1512 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-[(methylanilino)sulfonyl]-3-thiophenecarboxylic acid |
| 4-(N-phenyl-N-methyl)sulfamoylthiophene 3-carboxylic acid |
| 3-Thiophenecarboxylicacid,4-[(methylphenylamino)sulfonyl] |
| 4-((Methylphenylamino)sulfonyl)-3-thiophenecarboxylic acid |