4-(4-bromophenyl)cyclohexane-1-carbaldehyde
Modify Date: 2025-09-18 17:58:19
4-(4-bromophenyl)cyclohexane-1-carbaldehyde structure
|
Common Name | 4-(4-bromophenyl)cyclohexane-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 140922-86-7 | Molecular Weight | 267.16200 | |
| Density | 1.381g/cm3 | Boiling Point | 342.3ºC at 760mmHg | |
| Molecular Formula | C13H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 57.4ºC | |
| Name | 4-(4-bromophenyl)cyclohexane-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 342.3ºC at 760mmHg |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.16200 |
| Flash Point | 57.4ºC |
| Exact Mass | 266.03100 |
| PSA | 17.07000 |
| LogP | 3.92180 |
| Vapour Pressure | 7.59E-05mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | ACGCXIANOSUGIS-UHFFFAOYSA-N |
| SMILES | O=CC1CCC(c2ccc(Br)cc2)CC1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Cyclohexanecarboxaldehyde,4-(4-bromophenyl) |
| 4-(4-Bromophenyl)-cyclohexanecarboxaldehyde |