1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-
1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl- structure
|
Common Name | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 140631-53-4 | Molecular Weight | 306.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-Dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17Cl2N |
|---|---|
| Molecular Weight | 306.23000 |
| Exact Mass | 305.07400 |
| PSA | 12.03000 |
| LogP | 5.57050 |
| InChIKey | VGKDLMBJGBXTGI-UHFFFAOYSA-N |
| SMILES | CNC1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| HS Code | 2921499090 |
|---|
|
~94%
1-Naphthalenami... CAS#:140631-53-4 |
| Literature: WO2007/119247 A2, ; Page/Page column 23 ; |
|
~%
1-Naphthalenami... CAS#:140631-53-4 |
| Literature: Advanced Synthesis and Catalysis, , vol. 349, # 17-18 p. 2655 - 2659 |
|
~%
1-Naphthalenami... CAS#:140631-53-4 |
| Literature: US2003/50509 A1, ; |
|
~%
1-Naphthalenami... CAS#:140631-53-4 |
| Literature: Advanced Synthesis and Catalysis, , vol. 349, # 17-18 p. 2655 - 2659 |
|
~%
Detail
|
| Literature: WO2003/99761 A1, ; Page 4; 10 ; |
|
~88%
1-Naphthalenami... CAS#:140631-53-4 |
| Literature: Organometallics, , vol. 30, # 17 p. 4497 - 4500 |
![trans-(1R,4S)(+)-N-[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthyl]-N-methyl formamide structure](https://image.chemsrc.com/caspic/499/244263-56-7.png)
CAS#:79617-89-3| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| cis/trans-N-methyl-4-(3,4-dichlorophenyl)-1,2,3,4-terahydro-1-(2H)-napthalenamine |
| 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine |
| Trans(1R)(4S)-N-methyl-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |
| 4-(3,4-DICHLOROPHENYL)-1,2,3,4-TETRAHYDRO-N-METHYL-1-NAPHTHYLAMINE |
| N-methyl-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthaleneamine |
| Cis-(1S)(1R)-N-methyl-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |
| (1S,4S)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine |
| N-methyl-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |