4-decylbenzenesulfonic acid structure
|
Common Name | 4-decylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 140-60-3 | Molecular Weight | 298.44100 | |
| Density | 1.077g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H26O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-decylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.44100 |
| Exact Mass | 298.16000 |
| PSA | 62.75000 |
| LogP | 5.69730 |
| Index of Refraction | 1.513 |
| InChIKey | UASQKKHYUPBQJR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(S(=O)(=O)O)cc1 |
| HS Code | 2904100000 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| p-N-Decylbenzenesulfonate |
| Benzenesulfonic acid,4-decyl |
| 4-decyl-benzenesulfonic acid |
| 4-Decyl-benzolsulfonsaeure-(1) |
| 4-Decyl-benzolsulfonsaeure |
| Benzenesulfonic acid,p-decyl |
| p-Decylbenzenesulphonic acid |
| p-n-Decylbenzolsulfonsaeure |
| EINECS 205-422-0 |
| p-decylbenzenesulfonic acid |