Butanedioic acid,1-(phenylmethyl) ester, sodium salt (1:1)
Modify Date: 2025-09-11 18:15:55
Butanedioic acid,1-(phenylmethyl) ester, sodium salt (1:1) structure
|
Common Name | Butanedioic acid,1-(phenylmethyl) ester, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 140-21-6 | Molecular Weight | 230.19200 | |
| Density | N/A | Boiling Point | 368.5ºC at 760mmHg | |
| Molecular Formula | C11H11NaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | sodium benzylsuccinate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 368.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H11NaO4 |
| Molecular Weight | 230.19200 |
| Flash Point | 144.5ºC |
| Exact Mass | 230.05600 |
| PSA | 66.43000 |
| LogP | 0.25990 |
| Vapour Pressure | 4.41E-06mmHg at 25°C |
| InChIKey | YGNKLAAUOIITPV-UHFFFAOYSA-M |
| SMILES | O=C([O-])CCC(=O)OCc1ccccc1.[Na+] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butanedioic acid 1-benzyl 4-sodium salt |
| 3-(Phenylmethoxycarbonyl)propanoic acid sodium salt |
| sodium 3-benzyloxycarbonyl-propionate |
| EINECS 205-402-1 |