Setafrastat structure
|
Common Name | Setafrastat | ||
|---|---|---|---|---|
| CAS Number | 1399715-48-0 | Molecular Weight | 477.544 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 636.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H33F2N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.9±31.5 °C | |
Use of SetafrastatSetafrastat is a small molecule hair growth stimulator. |
| Name | Setafrastat |
|---|---|
| Synonym | More Synonyms |
| Description | Setafrastat is a small molecule hair growth stimulator. |
|---|---|
| References | References 1. Patent WO 2016136883 A1. View Related Products by Target Other Targets |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 636.7±55.0 °C at 760 mmHg |
| Molecular Formula | C25H33F2N3O4 |
| Molecular Weight | 477.544 |
| Flash Point | 338.9±31.5 °C |
| Exact Mass | 477.243927 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | CSZFOLMDHFDLLR-FQEVSTJZSA-N |
| SMILES | CC1(C)CC(C)(C)CC(O)(C(F)(F)C(=O)N2CCCC2c2cc(COc3cccnc3)on2)C1 |
| 2,2-Difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)-1-(2-{5-[(3-pyridinyloxy)methyl]-1,2-oxazol-3-yl}-1-pyrrolidinyl)ethanone |
| Ethanone, 2,2-difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)-1-[2-[5-[(3-pyridinyloxy)methyl]-3-isoxazolyl]-1-pyrrolidinyl]- |
| Setafrastat |